C27H25N2S+ — CID 10223248
(2Z)-3-ethyl-2-[(Z)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]benzo[g][1,3]benzothiazole (PubChem CID 10223248) has the molecular formula C27H25N2S+ and a molecular weight of 409.58 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(Z)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]benzo[g][1,3]benzothiazole.
| Compound Name | (2Z)-3-ethyl-2-[(Z)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]benzo[g][1,3]benzothiazole |
|---|---|
| PubChem CID | 10223248 |
| Molecular Formula | C27H25N2S+ |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (2Z)-3-ethyl-2-[(Z)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]benzo[g][1,3]benzothiazole |
| SMILES | CCN1/C(=C/C=C\c2ccc3ccccc3[n+]2CC)Sc2c1ccc1ccccc21 |
| InChI | InChI=1S/C27H25N2S/c1-3-28-22(18-16-21-11-6-8-14-24(21)28)12-9-15-26-29(4-2)25-19-17-20-10-5-7-13-23(20)27(25)30-26/h5-19H,3-4H2,1-2H3/q+1 |
| InChIKey | APSKDNKOTXMDGR-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|