C24H23N2O3S+ — CID 22950169
2-[(2Z)-2-[(E)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]-6-methoxy-1,3-benzothiazol-3-yl]acetic acid (PubChem CID 22950169) has the molecular formula C24H23N2O3S+ and a molecular weight of 419.53 g/mol. Its IUPAC name is 2-[(2Z)-2-[(E)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]-6-methoxy-1,3-benzothiazol-3-yl]acetic acid.
| Compound Name | 2-[(2Z)-2-[(E)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]-6-methoxy-1,3-benzothiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 22950169 |
| Molecular Formula | C24H23N2O3S+ |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 2-[(2Z)-2-[(E)-3-(1-ethylquinolin-1-ium-2-yl)prop-2-enylidene]-6-methoxy-1,3-benzothiazol-3-yl]acetic acid |
| SMILES | CC[n+]1c(/C=C/C=C2\Sc3cc(OC)ccc3N2CC(=O)O)ccc2ccccc21 |
| InChI | InChI=1S/C24H22N2O3S/c1-3-25-18(12-11-17-7-4-5-9-20(17)25)8-6-10-23-26(16-24(27)28)21-14-13-19(29-2)15-22(21)30-23/h4-15H,3,16H2,1-2H3/p+1 |
| InChIKey | IDAWTPYNBOJESH-UHFFFAOYSA-O |
| XLogP | 4.71 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|