C31H37N2O3S+ — CID 71129440
2-[(2Z)-2-[5-(1-ethylquinolin-1-ium-2-yl)-2,2,5-trimethylhex-3-enylidene]-6-methoxy-1,3-benzothiazol-3-yl]propanoic acid (PubChem CID 71129440) has the molecular formula C31H37N2O3S+ and a molecular weight of 517.72 g/mol. Its IUPAC name is 2-[(2Z)-2-[5-(1-ethylquinolin-1-ium-2-yl)-2,2,5-trimethylhex-3-enylidene]-6-methoxy-1,3-benzothiazol-3-yl]propanoic acid.
| Compound Name | 2-[(2Z)-2-[5-(1-ethylquinolin-1-ium-2-yl)-2,2,5-trimethylhex-3-enylidene]-6-methoxy-1,3-benzothiazol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 71129440 |
| Molecular Formula | C31H37N2O3S+ |
| Molecular Weight | 517.72 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 2-[(2Z)-2-[5-(1-ethylquinolin-1-ium-2-yl)-2,2,5-trimethylhex-3-enylidene]-6-methoxy-1,3-benzothiazol-3-yl]propanoic acid |
| SMILES | CC[n+]1c(C(C)(C)C=CC(C)(C)/C=C2\Sc3cc(OC)ccc3N2C(C)C(=O)O)ccc2ccccc21 |
| InChI | InChI=1S/C31H36N2O3S/c1-8-32-24-12-10-9-11-22(24)13-16-27(32)31(5,6)18-17-30(3,4)20-28-33(21(2)29(34)35)25-15-14-23(36-7)19-26(25)37-28/h9-21H,8H2,1-7H3/p+1/b18-17?,28-20- |
| InChIKey | PHLFGCJABAPSQI-CPNYYCNKSA-O |
| XLogP | 6.94 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.72 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|