C24H25NO2 — CID 22085729
14-butan-2-yl-10,18-dimethoxy-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),2,4,6,8(13),9,11,16,18-nonaene (PubChem CID 22085729) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 14-butan-2-yl-10,18-dimethoxy-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),2,4,6,8(13),9,11,16,18-nonaene.
| Compound Name | 14-butan-2-yl-10,18-dimethoxy-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),2,4,6,8(13),9,11,16,18-nonaene |
|---|---|
| PubChem CID | 22085729 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 14-butan-2-yl-10,18-dimethoxy-14-azatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),2,4,6,8(13),9,11,16,18-nonaene |
| SMILES | CCC(C)N1c2ccc(OC)cc2-c2ccccc2-c2cc(OC)ccc21 |
| InChI | InChI=1S/C24H25NO2/c1-5-16(2)25-23-12-10-17(26-3)14-21(23)19-8-6-7-9-20(19)22-15-18(27-4)11-13-24(22)25/h6-16H,5H2,1-4H3 |
| InChIKey | YZDCOWBXHTTWRI-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |