C13H19NO — CID 134286495
1-butan-2-yl-5-methoxy-2,3-dihydroindole (PubChem CID 134286495) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 1-butan-2-yl-5-methoxy-2,3-dihydroindole.
| Compound Name | 1-butan-2-yl-5-methoxy-2,3-dihydroindole |
|---|---|
| PubChem CID | 134286495 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 1-butan-2-yl-5-methoxy-2,3-dihydroindole |
| SMILES | CCC(C)N1CCc2cc(OC)ccc21 |
| InChI | InChI=1S/C13H19NO/c1-4-10(2)14-8-7-11-9-12(15-3)5-6-13(11)14/h5-6,9-10H,4,7-8H2,1-3H3 |
| InChIKey | KIWQGIKNQAPVQZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|