C17H19NO2 — CID 82974186
2-[1-(2,3-dihydroindol-1-yl)ethyl]-5-methoxyphenol (PubChem CID 82974186) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-[1-(2,3-dihydroindol-1-yl)ethyl]-5-methoxyphenol.
| Compound Name | 2-[1-(2,3-dihydroindol-1-yl)ethyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 82974186 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[1-(2,3-dihydroindol-1-yl)ethyl]-5-methoxyphenol |
| SMILES | COc1ccc(C(C)N2CCc3ccccc32)c(O)c1 |
| InChI | InChI=1S/C17H19NO2/c1-12(15-8-7-14(20-2)11-17(15)19)18-10-9-13-5-3-4-6-16(13)18/h3-8,11-12,19H,9-10H2,1-2H3 |
| InChIKey | OTUFNMBRQCRTHE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|