C16H16ClNO — CID 82974404
4-chloro-2-[1-(2,3-dihydroindol-1-yl)ethyl]phenol (PubChem CID 82974404) has the molecular formula C16H16ClNO and a molecular weight of 273.76 g/mol. Its IUPAC name is 4-chloro-2-[1-(2,3-dihydroindol-1-yl)ethyl]phenol.
| Compound Name | 4-chloro-2-[1-(2,3-dihydroindol-1-yl)ethyl]phenol |
|---|---|
| PubChem CID | 82974404 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 4-chloro-2-[1-(2,3-dihydroindol-1-yl)ethyl]phenol |
| SMILES | CC(c1cc(Cl)ccc1O)N1CCc2ccccc21 |
| InChI | InChI=1S/C16H16ClNO/c1-11(14-10-13(17)6-7-16(14)19)18-9-8-12-4-2-3-5-15(12)18/h2-7,10-11,19H,8-9H2,1H3 |
| InChIKey | HNBAUQQXNXYBGI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|