C17H17ClN2O — CID 8704432
(2R)-N-(3-chlorophenyl)-2-(2,3-dihydroindol-1-yl)propanamide (PubChem CID 8704432) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is (2R)-N-(3-chlorophenyl)-2-(2,3-dihydroindol-1-yl)propanamide.
| Compound Name | (2R)-N-(3-chlorophenyl)-2-(2,3-dihydroindol-1-yl)propanamide |
|---|---|
| PubChem CID | 8704432 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | (2R)-N-(3-chlorophenyl)-2-(2,3-dihydroindol-1-yl)propanamide |
| SMILES | C[C@H](C(=O)Nc1cccc(Cl)c1)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H17ClN2O/c1-12(17(21)19-15-7-4-6-14(18)11-15)20-10-9-13-5-2-3-8-16(13)20/h2-8,11-12H,9-10H2,1H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | NUTOFQNABFGIMF-GFCCVEGCSA-N |
| XLogP | 3.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |