C17H16Cl2N2O — CID 7940820
(2R)-N-(2,3-dichlorophenyl)-2-(2,3-dihydroindol-1-yl)propanamide (PubChem CID 7940820) has the molecular formula C17H16Cl2N2O and a molecular weight of 335.23 g/mol. Its IUPAC name is (2R)-N-(2,3-dichlorophenyl)-2-(2,3-dihydroindol-1-yl)propanamide.
| Compound Name | (2R)-N-(2,3-dichlorophenyl)-2-(2,3-dihydroindol-1-yl)propanamide |
|---|---|
| PubChem CID | 7940820 |
| Molecular Formula | C17H16Cl2N2O |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (2R)-N-(2,3-dichlorophenyl)-2-(2,3-dihydroindol-1-yl)propanamide |
| SMILES | C[C@H](C(=O)Nc1cccc(Cl)c1Cl)N1CCc2ccccc21 |
| InChI | InChI=1S/C17H16Cl2N2O/c1-11(21-10-9-12-5-2-3-8-15(12)21)17(22)20-14-7-4-6-13(18)16(14)19/h2-8,11H,9-10H2,1H3,(H,20,22)/t11-/m1/s1 |
| InChIKey | URRBDCYUYVQWLD-LLVKDONJSA-N |
| XLogP | 4.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |