C18H17F3N2O2 — CID 7998746
(2R)-2-(2,3-dihydroindol-1-yl)-N-[4-(trifluoromethoxy)phenyl]propanamide (PubChem CID 7998746) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is (2R)-2-(2,3-dihydroindol-1-yl)-N-[4-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | (2R)-2-(2,3-dihydroindol-1-yl)-N-[4-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 7998746 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (2R)-2-(2,3-dihydroindol-1-yl)-N-[4-(trifluoromethoxy)phenyl]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(OC(F)(F)F)cc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H17F3N2O2/c1-12(23-11-10-13-4-2-3-5-16(13)23)17(24)22-14-6-8-15(9-7-14)25-18(19,20)21/h2-9,12H,10-11H2,1H3,(H,22,24)/t12-/m1/s1 |
| InChIKey | IFPPYKFQTFZFTB-GFCCVEGCSA-N |
| XLogP | 3.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |