C18H21NO — CID 82980720
2-[1-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)ethyl]phenol (PubChem CID 82980720) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-[1-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)ethyl]phenol.
| Compound Name | 2-[1-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)ethyl]phenol |
|---|---|
| PubChem CID | 82980720 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-[1-(2,3,4,5-tetrahydro-1-benzazepin-1-yl)ethyl]phenol |
| SMILES | CC(c1ccccc1O)N1CCCCc2ccccc21 |
| InChI | InChI=1S/C18H21NO/c1-14(16-10-3-5-12-18(16)20)19-13-7-6-9-15-8-2-4-11-17(15)19/h2-5,8,10-12,14,20H,6-7,9,13H2,1H3 |
| InChIKey | XVZRNCHCCYUEEO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|