C64H66N2O4 — CID 139041670
6-[(2S)-butan-2-yl]-2,10-bis(4-methoxyphenyl)-5,7-dihydrobenzo[d][2]benzazepine (PubChem CID 139041670) has the molecular formula C64H66N2O4 and a molecular weight of 927.24 g/mol. Its IUPAC name is 6-[(2S)-butan-2-yl]-2,10-bis(4-methoxyphenyl)-5,7-dihydrobenzo[d][2]benzazepine.
| Compound Name | 6-[(2S)-butan-2-yl]-2,10-bis(4-methoxyphenyl)-5,7-dihydrobenzo[d][2]benzazepine |
|---|---|
| PubChem CID | 139041670 |
| Molecular Formula | C64H66N2O4 |
| Molecular Weight | 927.24 g/mol |
| Exact Mass | 926.50 |
| IUPAC Name | 6-[(2S)-butan-2-yl]-2,10-bis(4-methoxyphenyl)-5,7-dihydrobenzo[d][2]benzazepine |
| SMILES | CC[C@H](C)N1Cc2ccc(-c3ccc(OC)cc3)cc2-c2cc(-c3ccc(OC)cc3)ccc2C1.CC[C@H](C)N1Cc2ccc(-c3ccc(OC)cc3)cc2-c2cc(-c3ccc(OC)cc3)ccc2C1 |
| InChI | InChI=1S/2C32H33NO2/c2*1-5-22(2)33-20-27-8-6-25(23-10-14-29(34-3)15-11-23)18-31(27)32-19-26(7-9-28(32)21-33)24-12-16-30(35-4)17-13-24/h2*6-19,22H,5,20-21H2,1-4H3/t2*22-/m00/s1 |
| InChIKey | SNEWOWKCQJLZHC-DKHSGRLGSA-N |
| XLogP | 15.64 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.24 |
| LogP ≤ 5 | 15.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |