C29H26N2O2 — CID 11532152
5,13-bis(4-methoxyphenyl)-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (PubChem CID 11532152) has the molecular formula C29H26N2O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 5,13-bis(4-methoxyphenyl)-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene.
| Compound Name | 5,13-bis(4-methoxyphenyl)-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 11532152 |
| Molecular Formula | C29H26N2O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 5,13-bis(4-methoxyphenyl)-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| SMILES | COc1ccc(-c2ccc3c(c2)CN2CN3Cc3cc(-c4ccc(OC)cc4)ccc32)cc1 |
| InChI | InChI=1S/C29H26N2O2/c1-32-26-9-3-20(4-10-26)22-7-13-28-24(15-22)17-30-19-31(28)18-25-16-23(8-14-29(25)30)21-5-11-27(33-2)12-6-21/h3-16H,17-19H2,1-2H3 |
| InChIKey | FMGQIGYZOFBMTQ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |