C16H17N3 — CID 10514911
13-methyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-amine (PubChem CID 10514911) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 13-methyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-amine.
| Compound Name | 13-methyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-amine |
|---|---|
| PubChem CID | 10514911 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 13-methyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-amine |
| SMILES | Cc1ccc2c(c1)CN1CN2Cc2cc(N)ccc21 |
| InChI | InChI=1S/C16H17N3/c1-11-2-4-15-12(6-11)8-18-10-19(15)9-13-7-14(17)3-5-16(13)18/h2-7H,8-10,17H2,1H3 |
| InChIKey | SGNUCRBUQDJKDU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|