C11H17N3 — CID 146338288
1,4-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-7-amine (PubChem CID 146338288) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 1,4-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-7-amine.
| Compound Name | 1,4-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-7-amine |
|---|---|
| PubChem CID | 146338288 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 1,4-dimethyl-3,5-dihydro-2H-1,4-benzodiazepin-7-amine |
| SMILES | CN1CCN(C)c2ccc(N)cc2C1 |
| InChI | InChI=1S/C11H17N3/c1-13-5-6-14(2)11-4-3-10(12)7-9(11)8-13/h3-4,7H,5-6,8,12H2,1-2H3 |
| InChIKey | FWNNHVOXMSDKAR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|