C9H10IN — CID 134548249
1-iodo-5-methyl-2,3-dihydroindole (PubChem CID 134548249) has the molecular formula C9H10IN and a molecular weight of 259.09 g/mol. Its IUPAC name is 1-iodo-5-methyl-2,3-dihydroindole.
| Compound Name | 1-iodo-5-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 134548249 |
| Molecular Formula | C9H10IN |
| Molecular Weight | 259.09 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 1-iodo-5-methyl-2,3-dihydroindole |
| SMILES | Cc1ccc2c(c1)CCN2I |
| InChI | InChI=1S/C9H10IN/c1-7-2-3-9-8(6-7)4-5-11(9)10/h2-3,6H,4-5H2,1H3 |
| InChIKey | HMUFILYAOIOHKS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.09 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|