C9H10ClN — CID 54202425
1-chloro-5-methyl-2,3-dihydroindole (PubChem CID 54202425) has the molecular formula C9H10ClN and a molecular weight of 167.64 g/mol. Its IUPAC name is 1-chloro-5-methyl-2,3-dihydroindole.
| Compound Name | 1-chloro-5-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 54202425 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 1-chloro-5-methyl-2,3-dihydroindole |
| SMILES | Cc1ccc2c(c1)CCN2Cl |
| InChI | InChI=1S/C9H10ClN/c1-7-2-3-9-8(6-7)4-5-11(9)10/h2-3,6H,4-5H2,1H3 |
| InChIKey | PQELMSRMIVCIMP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|