C19H19NO3 — CID 67696129
2-[4-(3-methoxyphenyl)butan-2-yl]isoindole-1,3-dione (PubChem CID 67696129) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[4-(3-methoxyphenyl)butan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[4-(3-methoxyphenyl)butan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67696129 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[4-(3-methoxyphenyl)butan-2-yl]isoindole-1,3-dione |
| SMILES | COc1cccc(CCC(C)N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C19H19NO3/c1-13(10-11-14-6-5-7-15(12-14)23-2)20-18(21)16-8-3-4-9-17(16)19(20)22/h3-9,12-13H,10-11H2,1-2H3 |
| InChIKey | WHZONJFVILXDBS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|