C20H18FNO3 — CID 66983318
2-[(E)-2-fluoro-5-(3-methoxyphenyl)pent-2-enyl]isoindole-1,3-dione (PubChem CID 66983318) has the molecular formula C20H18FNO3 and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[(E)-2-fluoro-5-(3-methoxyphenyl)pent-2-enyl]isoindole-1,3-dione.
| Compound Name | 2-[(E)-2-fluoro-5-(3-methoxyphenyl)pent-2-enyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 66983318 |
| Molecular Formula | C20H18FNO3 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-[(E)-2-fluoro-5-(3-methoxyphenyl)pent-2-enyl]isoindole-1,3-dione |
| SMILES | COc1cccc(CC/C=C(/F)CN2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C20H18FNO3/c1-25-16-9-5-7-14(12-16)6-4-8-15(21)13-22-19(23)17-10-2-3-11-18(17)20(22)24/h2-3,5,7-12H,4,6,13H2,1H3/b15-8+ |
| InChIKey | BIWJWXCDEJGXBA-OVCLIPMQSA-N |
| XLogP | 3.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|