C12H17ClFNO — CID 66983281
2-fluoro-5-(3-methoxyphenyl)pent-2-en-1-amine;hydrochloride (PubChem CID 66983281) has the molecular formula C12H17ClFNO and a molecular weight of 245.73 g/mol. Its IUPAC name is 2-fluoro-5-(3-methoxyphenyl)pent-2-en-1-amine;hydrochloride.
| Compound Name | 2-fluoro-5-(3-methoxyphenyl)pent-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 66983281 |
| Molecular Formula | C12H17ClFNO |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-fluoro-5-(3-methoxyphenyl)pent-2-en-1-amine;hydrochloride |
| SMILES | COc1cccc(CCC=C(F)CN)c1.Cl |
| InChI | InChI=1S/C12H16FNO.ClH/c1-15-12-7-3-5-10(8-12)4-2-6-11(13)9-14;/h3,5-8H,2,4,9,14H2,1H3;1H |
| InChIKey | REPWMURIZVJMPP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |