C11H15ClFNO — CID 66983256
(Z)-2-fluoro-4-(3-methoxyphenyl)but-2-en-1-amine;hydrochloride (PubChem CID 66983256) has the molecular formula C11H15ClFNO and a molecular weight of 231.70 g/mol. Its IUPAC name is (Z)-2-fluoro-4-(3-methoxyphenyl)but-2-en-1-amine;hydrochloride.
| Compound Name | (Z)-2-fluoro-4-(3-methoxyphenyl)but-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 66983256 |
| Molecular Formula | C11H15ClFNO |
| Molecular Weight | 231.70 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | (Z)-2-fluoro-4-(3-methoxyphenyl)but-2-en-1-amine;hydrochloride |
| SMILES | COc1cccc(C/C=C(\F)CN)c1.Cl |
| InChI | InChI=1S/C11H14FNO.ClH/c1-14-11-4-2-3-9(7-11)5-6-10(12)8-13;/h2-4,6-7H,5,8,13H2,1H3;1H/b10-6-; |
| InChIKey | SISPSLYHDLPJPX-OTUCAILMSA-N |
| XLogP | 2.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.70 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |