C16H14N2O3 — CID 850937
4-amino-2-[(3-methoxyphenyl)methyl]isoindole-1,3-dione (PubChem CID 850937) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-amino-2-[(3-methoxyphenyl)methyl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[(3-methoxyphenyl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 850937 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-amino-2-[(3-methoxyphenyl)methyl]isoindole-1,3-dione |
| SMILES | COc1cccc(CN2C(=O)c3cccc(N)c3C2=O)c1 |
| InChI | InChI=1S/C16H14N2O3/c1-21-11-5-2-4-10(8-11)9-18-15(19)12-6-3-7-13(17)14(12)16(18)20/h2-8H,9,17H2,1H3 |
| InChIKey | OOMXPVHDUGIAIP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|