C14H14N4O2 — CID 62128305
4-amino-2-[(1-ethylpyrazol-4-yl)methyl]isoindole-1,3-dione (PubChem CID 62128305) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 4-amino-2-[(1-ethylpyrazol-4-yl)methyl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[(1-ethylpyrazol-4-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 62128305 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 4-amino-2-[(1-ethylpyrazol-4-yl)methyl]isoindole-1,3-dione |
| SMILES | CCn1cc(CN2C(=O)c3cccc(N)c3C2=O)cn1 |
| InChI | InChI=1S/C14H14N4O2/c1-2-17-7-9(6-16-17)8-18-13(19)10-4-3-5-11(15)12(10)14(18)20/h3-7H,2,8,15H2,1H3 |
| InChIKey | UMBHNTLJWVMOTD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|