C13H9ClN2O2S — CID 18072803
4-amino-2-[(5-chlorothiophen-2-yl)methyl]isoindole-1,3-dione (PubChem CID 18072803) has the molecular formula C13H9ClN2O2S and a molecular weight of 292.75 g/mol. Its IUPAC name is 4-amino-2-[(5-chlorothiophen-2-yl)methyl]isoindole-1,3-dione.
| Compound Name | 4-amino-2-[(5-chlorothiophen-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18072803 |
| Molecular Formula | C13H9ClN2O2S |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 4-amino-2-[(5-chlorothiophen-2-yl)methyl]isoindole-1,3-dione |
| SMILES | Nc1cccc2c1C(=O)N(Cc1ccc(Cl)s1)C2=O |
| InChI | InChI=1S/C13H9ClN2O2S/c14-10-5-4-7(19-10)6-16-12(17)8-2-1-3-9(15)11(8)13(16)18/h1-5H,6,15H2 |
| InChIKey | TWSFVAFVLNBZRT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|