C8H12N6 — CID 62126352
1-[(1-ethylpyrazol-4-yl)methyl]-1,2,4-triazol-3-amine (PubChem CID 62126352) has the molecular formula C8H12N6 and a molecular weight of 192.23 g/mol. Its IUPAC name is 1-[(1-ethylpyrazol-4-yl)methyl]-1,2,4-triazol-3-amine.
| Compound Name | 1-[(1-ethylpyrazol-4-yl)methyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 62126352 |
| Molecular Formula | C8H12N6 |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 1-[(1-ethylpyrazol-4-yl)methyl]-1,2,4-triazol-3-amine |
| SMILES | CCn1cc(Cn2cnc(N)n2)cn1 |
| InChI | InChI=1S/C8H12N6/c1-2-13-4-7(3-11-13)5-14-6-10-8(9)12-14/h3-4,6H,2,5H2,1H3,(H2,9,12) |
| InChIKey | NXKJGRNYTGXLQS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |