C9H18N2 — CID 143641951
1,4-diethylpyrazole;ethane (PubChem CID 143641951) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 1,4-diethylpyrazole;ethane.
| Compound Name | 1,4-diethylpyrazole;ethane |
|---|---|
| PubChem CID | 143641951 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1,4-diethylpyrazole;ethane |
| SMILES | CC.CCc1cnn(CC)c1 |
| InChI | InChI=1S/C7H12N2.C2H6/c1-3-7-5-8-9(4-2)6-7;1-2/h5-6H,3-4H2,1-2H3;1-2H3 |
| InChIKey | BXLUGHAQIHCQIJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |