About ethane;4-ethyl-1-methylpyrazole
ethane;4-ethyl-1-methylpyrazole (PubChem CID 143829284) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is ethane;4-ethyl-1-methylpyrazole.
Molecular Properties
| Compound Name | ethane;4-ethyl-1-methylpyrazole |
| PubChem CID | 143829284 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | ethane;4-ethyl-1-methylpyrazole |
| SMILES | CC.CC.CCc1cnn(C)c1 |
| InChI | InChI=1S/C6H10N2.2C2H6/c1-3-6-4-7-8(2)5-6;2*1-2/h4-5H,3H2,1-2H3;2*1-2H3 |
| InChIKey | CPRAHBTYMCZIKS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-ethyl-1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethyl-1-methylpyrazole?
The IUPAC name of ethane;4-ethyl-1-methylpyrazole (CID 143829284) is ethane;4-ethyl-1-methylpyrazole.
What is the SMILES notation for ethane;4-ethyl-1-methylpyrazole?
The canonical SMILES for ethane;4-ethyl-1-methylpyrazole is CC.CC.CCc1cnn(C)c1.
What is the InChIKey of ethane;4-ethyl-1-methylpyrazole?
The InChIKey is CPRAHBTYMCZIKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.2C2H6/c1-3-6-4-7-8(2)5-6;2*1-2/h4-5H,3H2,1-2H3;2*1-2H3.
What are the key properties of ethane;4-ethyl-1-methylpyrazole?
ethane;4-ethyl-1-methylpyrazole has a molecular weight of 170.30 g/mol, XLogP of 3.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethyl-1-methylpyrazole is sourced from PubChem (CID 143829284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).