C9H16BrN3 — CID 104554967
1-bromo-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]propan-2-amine (PubChem CID 104554967) has the molecular formula C9H16BrN3 and a molecular weight of 246.15 g/mol. Its IUPAC name is 1-bromo-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]propan-2-amine.
| Compound Name | 1-bromo-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 104554967 |
| Molecular Formula | C9H16BrN3 |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 1-bromo-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]propan-2-amine |
| SMILES | CC(CBr)N(C)Cc1cnn(C)c1 |
| InChI | InChI=1S/C9H16BrN3/c1-8(4-10)12(2)6-9-5-11-13(3)7-9/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | ANGVHOXXGVVGLQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|