C11H18N4 — CID 55211862
2-[(1-ethylpyrazol-4-yl)methyl-propylamino]acetonitrile (PubChem CID 55211862) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-[(1-ethylpyrazol-4-yl)methyl-propylamino]acetonitrile.
| Compound Name | 2-[(1-ethylpyrazol-4-yl)methyl-propylamino]acetonitrile |
|---|---|
| PubChem CID | 55211862 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 2-[(1-ethylpyrazol-4-yl)methyl-propylamino]acetonitrile |
| SMILES | CCCN(CC#N)Cc1cnn(CC)c1 |
| InChI | InChI=1S/C11H18N4/c1-3-6-14(7-5-12)9-11-8-13-15(4-2)10-11/h8,10H,3-4,6-7,9H2,1-2H3 |
| InChIKey | CGQLOZIXBGVUGD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|