C15H23N3O — CID 46991462
N-[(1-ethylpyrazol-4-yl)methyl]-N-(furan-3-ylmethyl)-2-methylpropan-1-amine (PubChem CID 46991462) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is N-[(1-ethylpyrazol-4-yl)methyl]-N-(furan-3-ylmethyl)-2-methylpropan-1-amine.
| Compound Name | N-[(1-ethylpyrazol-4-yl)methyl]-N-(furan-3-ylmethyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 46991462 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | N-[(1-ethylpyrazol-4-yl)methyl]-N-(furan-3-ylmethyl)-2-methylpropan-1-amine |
| SMILES | CCn1cc(CN(Cc2ccoc2)CC(C)C)cn1 |
| InChI | InChI=1S/C15H23N3O/c1-4-18-11-15(7-16-18)10-17(8-13(2)3)9-14-5-6-19-12-14/h5-7,11-13H,4,8-10H2,1-3H3 |
| InChIKey | JFABXUJGSGMBQQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 34.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |