C19H16ClNO3 — CID 142721281
2-chloro-3-[2-(3-methoxyphenyl)ethylamino]naphthalene-1,4-dione (PubChem CID 142721281) has the molecular formula C19H16ClNO3 and a molecular weight of 341.79 g/mol. Its IUPAC name is 2-chloro-3-[2-(3-methoxyphenyl)ethylamino]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[2-(3-methoxyphenyl)ethylamino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 142721281 |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-chloro-3-[2-(3-methoxyphenyl)ethylamino]naphthalene-1,4-dione |
| SMILES | COc1cccc(CCNC2=C(Cl)C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C19H16ClNO3/c1-24-13-6-4-5-12(11-13)9-10-21-17-16(20)18(22)14-7-2-3-8-15(14)19(17)23/h2-8,11,21H,9-10H2,1H3 |
| InChIKey | ZBYXQUUMBOBQNS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|