C15H18N2O — CID 107844845
2-N-[2-(3-methoxyphenyl)ethyl]benzene-1,2-diamine (PubChem CID 107844845) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-N-[2-(3-methoxyphenyl)ethyl]benzene-1,2-diamine.
| Compound Name | 2-N-[2-(3-methoxyphenyl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 107844845 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 2-N-[2-(3-methoxyphenyl)ethyl]benzene-1,2-diamine |
| SMILES | COc1cccc(CCNc2ccccc2N)c1 |
| InChI | InChI=1S/C15H18N2O/c1-18-13-6-4-5-12(11-13)9-10-17-15-8-3-2-7-14(15)16/h2-8,11,17H,9-10,16H2,1H3 |
| InChIKey | LMNOUYPQCKZBQW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|