C14H16ClN3O — CID 107845206
6-chloro-2-N-[2-(3-methoxyphenyl)ethyl]pyridine-2,3-diamine (PubChem CID 107845206) has the molecular formula C14H16ClN3O and a molecular weight of 277.76 g/mol. Its IUPAC name is 6-chloro-2-N-[2-(3-methoxyphenyl)ethyl]pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-[2-(3-methoxyphenyl)ethyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 107845206 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 6-chloro-2-N-[2-(3-methoxyphenyl)ethyl]pyridine-2,3-diamine |
| SMILES | COc1cccc(CCNc2nc(Cl)ccc2N)c1 |
| InChI | InChI=1S/C14H16ClN3O/c1-19-11-4-2-3-10(9-11)7-8-17-14-12(16)5-6-13(15)18-14/h2-6,9H,7-8,16H2,1H3,(H,17,18) |
| InChIKey | HPLHTKHOQUKBEJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|