C16H20N2 — CID 115124548
2-N-[2-(3,4-dimethylphenyl)ethyl]benzene-1,2-diamine (PubChem CID 115124548) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-N-[2-(3,4-dimethylphenyl)ethyl]benzene-1,2-diamine.
| Compound Name | 2-N-[2-(3,4-dimethylphenyl)ethyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 115124548 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2-N-[2-(3,4-dimethylphenyl)ethyl]benzene-1,2-diamine |
| SMILES | Cc1ccc(CCNc2ccccc2N)cc1C |
| InChI | InChI=1S/C16H20N2/c1-12-7-8-14(11-13(12)2)9-10-18-16-6-4-3-5-15(16)17/h3-8,11,18H,9-10,17H2,1-2H3 |
| InChIKey | BUPXOSDFFDJOOB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|