C23H21N2O6S2+ — CID 102573652
2-[2-[3-[3-(carboxymethyl)-5-methoxy-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-5-methoxy-1,3-benzothiazol-3-yl]acetic acid (PubChem CID 102573652) has the molecular formula C23H21N2O6S2+ and a molecular weight of 485.56 g/mol. Its IUPAC name is 2-[2-[3-[3-(carboxymethyl)-5-methoxy-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-5-methoxy-1,3-benzothiazol-3-yl]acetic acid.
| Compound Name | 2-[2-[3-[3-(carboxymethyl)-5-methoxy-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-5-methoxy-1,3-benzothiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 102573652 |
| Molecular Formula | C23H21N2O6S2+ |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 2-[2-[3-[3-(carboxymethyl)-5-methoxy-1,3-benzothiazol-3-ium-2-yl]prop-2-enylidene]-5-methoxy-1,3-benzothiazol-3-yl]acetic acid |
| SMILES | COc1ccc2c(c1)N(CC(=O)O)C(=CC=Cc1sc3ccc(OC)cc3[n+]1CC(=O)O)S2 |
| InChI | InChI=1S/C23H20N2O6S2/c1-30-14-6-8-18-16(10-14)24(12-22(26)27)20(32-18)4-3-5-21-25(13-23(28)29)17-11-15(31-2)7-9-19(17)33-21/h3-11H,12-13H2,1-2H3,(H-,26,27,28,29)/p+1 |
| InChIKey | SRAOJHXPFKILIN-UHFFFAOYSA-O |
| XLogP | 3.84 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|