C27H29N2S2+ — CID 123271219
3-ethyl-2-[7-(3-ethyl-5-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-5-methyl-1,3-benzothiazole (PubChem CID 123271219) has the molecular formula C27H29N2S2+ and a molecular weight of 445.68 g/mol. Its IUPAC name is 3-ethyl-2-[7-(3-ethyl-5-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-5-methyl-1,3-benzothiazole.
| Compound Name | 3-ethyl-2-[7-(3-ethyl-5-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-5-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 123271219 |
| Molecular Formula | C27H29N2S2+ |
| Molecular Weight | 445.68 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 3-ethyl-2-[7-(3-ethyl-5-methyl-1,3-benzothiazol-3-ium-2-yl)hepta-2,4,6-trienylidene]-5-methyl-1,3-benzothiazole |
| SMILES | CCN1C(=CC=CC=CC=Cc2sc3ccc(C)cc3[n+]2CC)Sc2ccc(C)cc21 |
| InChI | InChI=1S/C27H29N2S2/c1-5-28-22-18-20(3)14-16-24(22)30-26(28)12-10-8-7-9-11-13-27-29(6-2)23-19-21(4)15-17-25(23)31-27/h7-19H,5-6H2,1-4H3/q+1 |
| InChIKey | WCMARMSMJFOFHZ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.68 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|