C29H33N2S6+ — CID 54462988
3-ethyl-2-[7-[3-ethyl-5,6-bis(methylsulfanyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-5,6-bis(methylsulfanyl)-1,3-benzothiazole (PubChem CID 54462988) has the molecular formula C29H33N2S6+ and a molecular weight of 602.00 g/mol. Its IUPAC name is 3-ethyl-2-[7-[3-ethyl-5,6-bis(methylsulfanyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-5,6-bis(methylsulfanyl)-1,3-benzothiazole.
| Compound Name | 3-ethyl-2-[7-[3-ethyl-5,6-bis(methylsulfanyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-5,6-bis(methylsulfanyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 54462988 |
| Molecular Formula | C29H33N2S6+ |
| Molecular Weight | 602.00 g/mol |
| Exact Mass | 601.10 |
| IUPAC Name | 3-ethyl-2-[7-[3-ethyl-5,6-bis(methylsulfanyl)-1,3-benzothiazol-3-ium-2-yl]hepta-2,4,6-trienylidene]-5,6-bis(methylsulfanyl)-1,3-benzothiazole |
| SMILES | CCN1C(=CC=CC=CC=Cc2sc3cc(SC)c(SC)cc3[n+]2CC)Sc2cc(SC)c(SC)cc21 |
| InChI | InChI=1S/C29H33N2S6/c1-7-30-20-16-24(32-3)26(34-5)18-22(20)36-28(30)14-12-10-9-11-13-15-29-31(8-2)21-17-25(33-4)27(35-6)19-23(21)37-29/h9-19H,7-8H2,1-6H3/q+1 |
| InChIKey | XCXFOKFKCPGDGI-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.00 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|