C36H48N+ — CID 123604445
12,12-diethyl-5,5,6,7,7,9-hexamethyl-11-methylidene-6-pentyl-13-azoniapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 123604445) has the molecular formula C36H48N+ and a molecular weight of 494.79 g/mol. Its IUPAC name is 12,12-diethyl-5,5,6,7,7,9-hexamethyl-11-methylidene-6-pentyl-13-azoniapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 12,12-diethyl-5,5,6,7,7,9-hexamethyl-11-methylidene-6-pentyl-13-azoniapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 123604445 |
| Molecular Formula | C36H48N+ |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 494.38 |
| IUPAC Name | 12,12-diethyl-5,5,6,7,7,9-hexamethyl-11-methylidene-6-pentyl-13-azoniapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | C=C1c2c(cc3c(c2C)C(C)(C)C(C)(CCCCC)C3(C)C)-c2ccc3ccccc3[n+]2C1(CC)CC |
| InChI | InChI=1S/C36H48N/c1-11-14-17-22-35(10)33(6,7)28-23-27-30-21-20-26-18-15-16-19-29(26)37(30)36(12-2,13-3)25(5)31(27)24(4)32(28)34(35,8)9/h15-16,18-21,23H,5,11-14,17,22H2,1-4,6-10H3/q+1 |
| InChIKey | XUTBCBWLXOVZIY-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|