C34H46N+ — CID 123682897
19,19-diethyl-5,5,7,11,11-pentamethyl-20-methylidene-7-pentyl-18-azoniapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene (PubChem CID 123682897) has the molecular formula C34H46N+ and a molecular weight of 468.75 g/mol. Its IUPAC name is 19,19-diethyl-5,5,7,11,11-pentamethyl-20-methylidene-7-pentyl-18-azoniapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene.
| Compound Name | 19,19-diethyl-5,5,7,11,11-pentamethyl-20-methylidene-7-pentyl-18-azoniapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene |
|---|---|
| PubChem CID | 123682897 |
| Molecular Formula | C34H46N+ |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | 19,19-diethyl-5,5,7,11,11-pentamethyl-20-methylidene-7-pentyl-18-azoniapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene |
| SMILES | C=C1C2=C(c3cccc[n+]3C1(CC)CC)C(C)(C)c1cc3c(cc12)C(C)(C)CC3(C)CCCCC |
| InChI | InChI=1S/C34H46N/c1-10-13-15-18-33(9)22-31(5,6)26-20-24-25(21-27(26)33)32(7,8)30-28-17-14-16-19-35(28)34(11-2,12-3)23(4)29(24)30/h14,16-17,19-21H,4,10-13,15,18,22H2,1-3,5-9H3/q+1 |
| InChIKey | XKBOPTAUOFPBHZ-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|