C32H36N+ — CID 123357561
6,6-diethyl-12,12-dimethyl-7-methylidene-10-(4-propylphenyl)indeno[2,1-a]quinolizin-5-ium (PubChem CID 123357561) has the molecular formula C32H36N+ and a molecular weight of 434.65 g/mol. Its IUPAC name is 6,6-diethyl-12,12-dimethyl-7-methylidene-10-(4-propylphenyl)indeno[2,1-a]quinolizin-5-ium.
| Compound Name | 6,6-diethyl-12,12-dimethyl-7-methylidene-10-(4-propylphenyl)indeno[2,1-a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123357561 |
| Molecular Formula | C32H36N+ |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 6,6-diethyl-12,12-dimethyl-7-methylidene-10-(4-propylphenyl)indeno[2,1-a]quinolizin-5-ium |
| SMILES | C=C1C2=C(c3cccc[n+]3C1(CC)CC)C(C)(C)c1cc(-c3ccc(CCC)cc3)ccc12 |
| InChI | InChI=1S/C32H36N/c1-7-12-23-14-16-24(17-15-23)25-18-19-26-27(21-25)31(5,6)30-28-13-10-11-20-33(28)32(8-2,9-3)22(4)29(26)30/h10-11,13-21H,4,7-9,12H2,1-3,5-6H3/q+1 |
| InChIKey | TYNPOQKQUOFBLE-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|