C42H36N+ — CID 123442926
10-[3-(3,5-diphenylphenyl)phenyl]-6,6-diethyl-7-methylidenebenzo[a]quinolizin-5-ium (PubChem CID 123442926) has the molecular formula C42H36N+ and a molecular weight of 554.76 g/mol. Its IUPAC name is 10-[3-(3,5-diphenylphenyl)phenyl]-6,6-diethyl-7-methylidenebenzo[a]quinolizin-5-ium.
| Compound Name | 10-[3-(3,5-diphenylphenyl)phenyl]-6,6-diethyl-7-methylidenebenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123442926 |
| Molecular Formula | C42H36N+ |
| Molecular Weight | 554.76 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | 10-[3-(3,5-diphenylphenyl)phenyl]-6,6-diethyl-7-methylidenebenzo[a]quinolizin-5-ium |
| SMILES | C=C1c2ccc(-c3cccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)c3)cc2-c2cccc[n+]2C1(CC)CC |
| InChI | InChI=1S/C42H36N/c1-4-42(5-2)30(3)39-23-22-35(29-40(39)41-21-12-13-24-43(41)42)33-19-14-20-34(25-33)38-27-36(31-15-8-6-9-16-31)26-37(28-38)32-17-10-7-11-18-32/h6-29H,3-5H2,1-2H3/q+1 |
| InChIKey | ZEVBDXITGYSILY-UHFFFAOYSA-N |
| XLogP | 10.85 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.76 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|