C39H35N2O+ — CID 123439269
17-(6,6-diethyl-7-methylidenebenzo[a]quinolizin-5-ium-10-yl)-14,14-dimethyl-8-oxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15(20),16,18-nonaene (PubChem CID 123439269) has the molecular formula C39H35N2O+ and a molecular weight of 547.72 g/mol. Its IUPAC name is 17-(6,6-diethyl-7-methylidenebenzo[a]quinolizin-5-ium-10-yl)-14,14-dimethyl-8-oxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 17-(6,6-diethyl-7-methylidenebenzo[a]quinolizin-5-ium-10-yl)-14,14-dimethyl-8-oxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 123439269 |
| Molecular Formula | C39H35N2O+ |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.27 |
| IUPAC Name | 17-(6,6-diethyl-7-methylidenebenzo[a]quinolizin-5-ium-10-yl)-14,14-dimethyl-8-oxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15(20),16,18-nonaene |
| SMILES | C=C1c2ccc(-c3ccc4c(c3)C(C)(C)c3cccc5c3N4c3ccccc3O5)cc2-c2cccc[n+]2C1(CC)CC |
| InChI | InChI=1S/C39H35N2O/c1-6-39(7-2)25(3)28-20-18-26(23-29(28)32-14-10-11-22-40(32)39)27-19-21-33-31(24-27)38(4,5)30-13-12-17-36-37(30)41(33)34-15-8-9-16-35(34)42-36/h8-24H,3,6-7H2,1-2,4-5H3/q+1 |
| InChIKey | XLOONFLCLMVWJZ-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|