C29H29N2+ — CID 123925570
6,6-diethyl-7-methyl-1,3-diphenyl-7H-pyrazino[2,1-a]isoquinolin-5-ium (PubChem CID 123925570) has the molecular formula C29H29N2+ and a molecular weight of 405.57 g/mol. Its IUPAC name is 6,6-diethyl-7-methyl-1,3-diphenyl-7H-pyrazino[2,1-a]isoquinolin-5-ium.
| Compound Name | 6,6-diethyl-7-methyl-1,3-diphenyl-7H-pyrazino[2,1-a]isoquinolin-5-ium |
|---|---|
| PubChem CID | 123925570 |
| Molecular Formula | C29H29N2+ |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 6,6-diethyl-7-methyl-1,3-diphenyl-7H-pyrazino[2,1-a]isoquinolin-5-ium |
| SMILES | CCC1(CC)C(C)c2ccccc2-c2c(-c3ccccc3)nc(-c3ccccc3)c[n+]21 |
| InChI | InChI=1S/C29H29N2/c1-4-29(5-2)21(3)24-18-12-13-19-25(24)28-27(23-16-10-7-11-17-23)30-26(20-31(28)29)22-14-8-6-9-15-22/h6-21H,4-5H2,1-3H3/q+1 |
| InChIKey | CGCWYKGNWFCRJO-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|