C31H33N2+ — CID 123956223
7-ethyl-7-pentan-2-yl-1,3-diphenyl-6H-pyrazino[2,1-a]isoquinolin-5-ium (PubChem CID 123956223) has the molecular formula C31H33N2+ and a molecular weight of 433.62 g/mol. Its IUPAC name is 7-ethyl-7-pentan-2-yl-1,3-diphenyl-6H-pyrazino[2,1-a]isoquinolin-5-ium.
| Compound Name | 7-ethyl-7-pentan-2-yl-1,3-diphenyl-6H-pyrazino[2,1-a]isoquinolin-5-ium |
|---|---|
| PubChem CID | 123956223 |
| Molecular Formula | C31H33N2+ |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 7-ethyl-7-pentan-2-yl-1,3-diphenyl-6H-pyrazino[2,1-a]isoquinolin-5-ium |
| SMILES | CCCC(C)C1(CC)C[n+]2cc(-c3ccccc3)nc(-c3ccccc3)c2-c2ccccc21 |
| InChI | InChI=1S/C31H33N2/c1-4-14-23(3)31(5-2)22-33-21-28(24-15-8-6-9-16-24)32-29(25-17-10-7-11-18-25)30(33)26-19-12-13-20-27(26)31/h6-13,15-21,23H,4-5,14,22H2,1-3H3/q+1 |
| InChIKey | MACNFEYSPJOYMR-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|