C21H29N — CID 15439664
3,4-diethyl-2-phenyl-5,6-dipropylpyridine (PubChem CID 15439664) has the molecular formula C21H29N and a molecular weight of 295.47 g/mol. Its IUPAC name is 3,4-diethyl-2-phenyl-5,6-dipropylpyridine.
| Compound Name | 3,4-diethyl-2-phenyl-5,6-dipropylpyridine |
|---|---|
| PubChem CID | 15439664 |
| Molecular Formula | C21H29N |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 3,4-diethyl-2-phenyl-5,6-dipropylpyridine |
| SMILES | CCCc1nc(-c2ccccc2)c(CC)c(CC)c1CCC |
| InChI | InChI=1S/C21H29N/c1-5-12-19-17(7-3)18(8-4)21(22-20(19)13-6-2)16-14-10-9-11-15-16/h9-11,14-15H,5-8,12-13H2,1-4H3 |
| InChIKey | GSXQPNWOSMUDDA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |