C22H24NS+ — CID 123349007
8-ethenyl-8,9-diethyl-9-methyl-14-thia-10-azoniatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,11,13(17),15-heptaene (PubChem CID 123349007) has the molecular formula C22H24NS+ and a molecular weight of 334.51 g/mol. Its IUPAC name is 8-ethenyl-8,9-diethyl-9-methyl-14-thia-10-azoniatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,11,13(17),15-heptaene.
| Compound Name | 8-ethenyl-8,9-diethyl-9-methyl-14-thia-10-azoniatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,11,13(17),15-heptaene |
|---|---|
| PubChem CID | 123349007 |
| Molecular Formula | C22H24NS+ |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 8-ethenyl-8,9-diethyl-9-methyl-14-thia-10-azoniatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,11,13(17),15-heptaene |
| SMILES | C=CC1(CC)c2ccccc2-c2c3ccsc3cc[n+]2C1(C)CC |
| InChI | InChI=1S/C22H24NS/c1-5-21(4)22(6-2,7-3)18-11-9-8-10-16(18)20-17-13-15-24-19(17)12-14-23(20)21/h6,8-15H,2,5,7H2,1,3-4H3/q+1 |
| InChIKey | FQLKBZIUTFRNPJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|