C27H27N2+ — CID 91513471
2,5-diethyl-13-phenyl-13-aza-1-azoniapentacyclo[10.7.0.02,5.06,11.014,19]nonadeca-1(12),6,8,10,14,16,18-heptaene (PubChem CID 91513471) has the molecular formula C27H27N2+ and a molecular weight of 379.53 g/mol. Its IUPAC name is 2,5-diethyl-13-phenyl-13-aza-1-azoniapentacyclo[10.7.0.02,5.06,11.014,19]nonadeca-1(12),6,8,10,14,16,18-heptaene.
| Compound Name | 2,5-diethyl-13-phenyl-13-aza-1-azoniapentacyclo[10.7.0.02,5.06,11.014,19]nonadeca-1(12),6,8,10,14,16,18-heptaene |
|---|---|
| PubChem CID | 91513471 |
| Molecular Formula | C27H27N2+ |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | 2,5-diethyl-13-phenyl-13-aza-1-azoniapentacyclo[10.7.0.02,5.06,11.014,19]nonadeca-1(12),6,8,10,14,16,18-heptaene |
| SMILES | CCC12CCC1(CC)[n+]1c(n(-c3ccccc3)c3ccccc31)-c1ccccc12 |
| InChI | InChI=1S/C27H27N2/c1-3-26-18-19-27(26,4-2)29-24-17-11-10-16-23(24)28(20-12-6-5-7-13-20)25(29)21-14-8-9-15-22(21)26/h5-17H,3-4,18-19H2,1-2H3/q+1 |
| InChIKey | IUYQSZDFIMHTEN-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|