C21H21BN+ — CID 123594591
CID 123594591 (PubChem CID 123594591) has the molecular formula C21H21BN+ and a molecular weight of 298.22 g/mol.
| Compound Name | CID 123594591 |
|---|---|
| PubChem CID | 123594591 |
| Molecular Formula | C21H21BN+ |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)-c1c3ccccc3cc[n+]1C(CC)(CC)C2 |
| InChI | InChI=1S/C21H21BN/c1-3-21(4-2)14-16-9-10-17(22)13-19(16)20-18-8-6-5-7-15(18)11-12-23(20)21/h5-13H,3-4,14H2,1-2H3/q+1 |
| InChIKey | QDBNNZQUJBTZOB-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|