C28H28NO2+ — CID 123416790
2,10-diethyl-5,7-dimethyl-4,8-dioxa-1-azoniahexacyclo[15.8.0.02,10.03,9.011,16.018,23]pentacosa-1(17),3(9),5,11,13,15,18,20,22,24-decaene (PubChem CID 123416790) has the molecular formula C28H28NO2+ and a molecular weight of 410.54 g/mol. Its IUPAC name is 2,10-diethyl-5,7-dimethyl-4,8-dioxa-1-azoniahexacyclo[15.8.0.02,10.03,9.011,16.018,23]pentacosa-1(17),3(9),5,11,13,15,18,20,22,24-decaene.
| Compound Name | 2,10-diethyl-5,7-dimethyl-4,8-dioxa-1-azoniahexacyclo[15.8.0.02,10.03,9.011,16.018,23]pentacosa-1(17),3(9),5,11,13,15,18,20,22,24-decaene |
|---|---|
| PubChem CID | 123416790 |
| Molecular Formula | C28H28NO2+ |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2,10-diethyl-5,7-dimethyl-4,8-dioxa-1-azoniahexacyclo[15.8.0.02,10.03,9.011,16.018,23]pentacosa-1(17),3(9),5,11,13,15,18,20,22,24-decaene |
| SMILES | CCC12C3=C(OC(C)=CC(C)O3)C1(CC)[n+]1ccc3ccccc3c1-c1ccccc12 |
| InChI | InChI=1S/C28H28NO2/c1-5-27-23-14-10-9-13-22(23)24-21-12-8-7-11-20(21)15-16-29(24)28(27,6-2)26-25(27)30-18(3)17-19(4)31-26/h7-18H,5-6H2,1-4H3/q+1 |
| InChIKey | ZSSHHHZXDDIDRQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|