C27H37FN+ — CID 123569412
6,7-diethyl-1-fluoro-6,7,9,9,12,12-hexamethyl-10,11-dihydronaphtho[2,3-a]quinolizin-5-ium (PubChem CID 123569412) has the molecular formula C27H37FN+ and a molecular weight of 394.60 g/mol. Its IUPAC name is 6,7-diethyl-1-fluoro-6,7,9,9,12,12-hexamethyl-10,11-dihydronaphtho[2,3-a]quinolizin-5-ium.
| Compound Name | 6,7-diethyl-1-fluoro-6,7,9,9,12,12-hexamethyl-10,11-dihydronaphtho[2,3-a]quinolizin-5-ium |
|---|---|
| PubChem CID | 123569412 |
| Molecular Formula | C27H37FN+ |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | 6,7-diethyl-1-fluoro-6,7,9,9,12,12-hexamethyl-10,11-dihydronaphtho[2,3-a]quinolizin-5-ium |
| SMILES | CCC1(C)c2cc3c(cc2-c2c(F)ccc[n+]2C1(C)CC)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C27H37FN/c1-9-26(7)19-17-21-20(24(3,4)13-14-25(21,5)6)16-18(19)23-22(28)12-11-15-29(23)27(26,8)10-2/h11-12,15-17H,9-10,13-14H2,1-8H3/q+1 |
| InChIKey | ANNVPUWFNCNGPT-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|